* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RUTAEVIN |
CAS: | 33237-37-5 |
English Synonyms: | RUTAEVIN |
MDL Number.: | MFCD00075954 |
H bond acceptor: | 9 |
H bond donor: | 1 |
Smile: | CC1([C@@H]2C(=O)[C@@H]([C@@]3([C@@H]([C@]24COC(=O)C[C@@H]4O1)CC[C@@]5([C@]36[C@H](O6)C(=O)O[C@H]5c7ccoc7)C)C)O)C |
InChi: | InChI=1S/C26H30O9/c1-22(2)17-16(28)18(29)24(4)13(25(17)11-32-15(27)9-14(25)34-22)5-7-23(3)19(12-6-8-31-10-12)33-21(30)20-26(23,24)35-20/h6,8,10,13-14,17-20,29H,5,7,9,11H2,1-4H3/t13-,14-,17-,18-,19-,20+,23-,24-,25-,26+/m0/s1 |
InChiKey: | InChIKey=YZMKFMIZNSOPSN-XGTMLCIVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.