* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HUMULONE |
| CAS: | 23510-81-8 ;26472-41-3 |
| English Synonyms: | HUMULON ; HUMULONE |
| MDL Number.: | MFCD00076002 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | CC(C)CC(=O)C1=C(C(=C([C@@](C1=O)(CC=C(C)C)O)O)CC=C(C)C)O |
| InChi: | InChI=1S/C21H30O5/c1-12(2)7-8-15-18(23)17(16(22)11-14(5)6)20(25)21(26,19(15)24)10-9-13(3)4/h7,9,14,23-24,26H,8,10-11H2,1-6H3/t21-/m1/s1 |
| InChiKey: | InChIKey=VMSLCPKYRPDHLN-OAQYLSRUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.