* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OXYPEUCEDANIN |
| CAS: | 26091-73-6 |
| English Synonyms: | OXYPEUCEDANIN |
| MDL Number.: | MFCD00076050 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | CC1([C@@H](O1)COC2=CCOc3c2cc4c(c3)OC(=O)C4)C |
| InChi: | InChI=1S/C16H16O5/c1-16(2)14(21-16)8-19-11-3-4-18-13-7-12-9(5-10(11)13)6-15(17)20-12/h3,5,7,14H,4,6,8H2,1-2H3/t14-/m0/s1 |
| InChiKey: | InChIKey=KUEXEFAECRHRKN-AWEZNQCLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.