* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | R-G-D-T |
English Synonyms: | R-G-D-T ; ARG-GLY-ASP-THR |
MDL Number.: | MFCD00076455 |
H bond acceptor: | 15 |
H bond donor: | 10 |
Smile: | C[C@H]([C@@H](C(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)CNC(=O)[C@H](CCCNC(=N)N)N)O |
InChi: | InChI=1S/C16H29N7O8/c1-7(24)12(15(30)31)23-14(29)9(5-11(26)27)22-10(25)6-21-13(28)8(17)3-2-4-20-16(18)19/h7-9,12,24H,2-6,17H2,1H3,(H,21,28)(H,22,25)(H,23,29)(H,26,27)(H,30,31)(H4,18,19,20)/t7-,8+,9+,12+/m1/s1 |
InChiKey: | InChIKey=RESYERROEGJEGB-ARHDFHRDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.