* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RGDV |
| CAS: | 93674-99-8 |
| English Synonyms: | H-ARG-GLY-ASP-VAL-OH ; RGDV ; ARG-GLY-ASP-VAL |
| MDL Number.: | MFCD00076456 |
| H bond acceptor: | 14 |
| H bond donor: | 9 |
| Smile: | CC(C)[C@@H](C(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)CNC(=O)[C@H](CCCNC(=N)N)N |
| InChi: | InChI=1S/C17H31N7O7/c1-8(2)13(16(30)31)24-15(29)10(6-12(26)27)23-11(25)7-22-14(28)9(18)4-3-5-21-17(19)20/h8-10,13H,3-7,18H2,1-2H3,(H,22,28)(H,23,25)(H,24,29)(H,26,27)(H,30,31)(H4,19,20,21)/t9-,10-,13-/m0/s1 |
| InChiKey: | InChIKey=MDNRBNZIOBQHHK-KWBADKCTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.