* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLY-ARG-GLY-GLU-SER |
| English Synonyms: | G-R-G-E-S ; GLY-ARG-GLY-GLU-SER |
| MDL Number.: | MFCD00076466 |
| H bond acceptor: | 17 |
| H bond donor: | 11 |
| Smile: | C(C[C@@H](C(=O)NCC(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CO)C(=O)O)NC(=O)CN)CNC(=N)N |
| InChi: | InChI=1S/C18H32N8O9/c19-6-12(28)24-9(2-1-5-22-18(20)21)15(32)23-7-13(29)25-10(3-4-14(30)31)16(33)26-11(8-27)17(34)35/h9-11,27H,1-8,19H2,(H,23,32)(H,24,28)(H,25,29)(H,26,33)(H,30,31)(H,34,35)(H4,20,21,22)/t9-,10-,11-/m0/s1 |
| InChiKey: | InChIKey=PXBRHUDUPKMASY-DCAQKATOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.