* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | L-L-CMK |
| CAS: | 61727-69-3 |
| English Synonyms: | L-L-CMK ; L-LEU-CMK |
| MDL Number.: | MFCD00077130 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC(C)C[C@@H](C(=O)CCl)N |
| InChi: | InChI=1S/C7H14ClNO/c1-5(2)3-6(9)7(10)4-8/h5-6H,3-4,9H2,1-2H3/t6-/m0/s1 |
| InChiKey: | InChIKey=PMNJWFVAVFZNFE-LURJTMIESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.