* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | LABOTEST-BB LT00454085 |
English Synonyms: | LABOTEST-BB LT00454085 |
MDL Number.: | MFCD00078277 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cc1cc(cc(c1O)Br)/C(=C\2/C=C(C(=O)C(=C2)Br)C)/c3cccc(c3)S(=O)(=O)[O-].[Na+] |
InChi: | InChI=1S/C21H16Br2O5S.Na/c1-11-6-14(9-17(22)20(11)24)19(15-7-12(2)21(25)18(23)10-15)13-4-3-5-16(8-13)29(26,27)28;/h3-10,24H,1-2H3,(H,26,27,28);/q;+1/p-1/b19-15-; |
InChiKey: | InChIKey=NCJQQHJFOCSXAY-HVENRQQKSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.