* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LT00771854 |
| English Synonyms: | LABOTEST-BB LT00771854 |
| MDL Number.: | MFCD00079025 |
| H bond acceptor: | 10 |
| H bond donor: | 2 |
| Smile: | c1cc(ccc1C(C(COC(=O)CCC(=O)[O-])NC(=O)C(Cl)Cl)O)[N+](=O)[O-].[Na+] |
| InChi: | InChI=1S/C15H16Cl2N2O8.Na/c16-14(17)15(24)18-10(7-27-12(22)6-5-11(20)21)13(23)8-1-3-9(4-2-8)19(25)26;/h1-4,10,13-14,23H,5-7H2,(H,18,24)(H,20,21);/q;+1/p-1 |
| InChiKey: | InChIKey=RPLOPBHEZLFENN-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.