* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GERMALLII |
| English Synonyms: | GERMALLII |
| MDL Number.: | MFCD00079129 |
| H bond acceptor: | 9 |
| H bond donor: | 5 |
| Smile: | C(NC(=O)N(CO)C1C(=O)NC(=O)N1)O |
| InChi: | InChI=1S/C6H10N4O5/c11-1-7-6(15)10(2-12)3-4(13)9-5(14)8-3/h3,11-12H,1-2H2,(H,7,15)(H2,8,9,13,14) |
| InChiKey: | InChIKey=NWTJKPIGLNSSTB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.