* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RADICININ |
| CAS: | 10088-95-6 ;1402-20-6 |
| English Synonyms: | RADICININ ; STEMPHYLONE |
| MDL Number.: | MFCD00079543 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | C/C=C/c1cc2c(c(=O)o1)C(=O)[C@@H]([C@H](O2)C)O |
| InChi: | InChI=1S/C12H12O5/c1-3-4-7-5-8-9(12(15)17-7)11(14)10(13)6(2)16-8/h3-6,10,13H,1-2H3/b4-3+/t6-,10-/m1/s1 |
| InChiKey: | InChIKey=SDKXGAICTNHFCN-USOFOCCVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.