* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GLY-LEU-MET-NH2 |
CAS: | 4652-64-6 |
English Synonyms: | GLY-LEU-MET-NH2 ; SUBSTANCE P (9-11) ; H-GLY-LEU-MET-NH2 ; GLM-NH2 |
MDL Number.: | MFCD00080136 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | CC(C)C[C@@H](C(=O)N[C@@H](CCSC)C(=O)N)NC(=O)CN |
InChi: | InChI=1S/C13H26N4O3S/c1-8(2)6-10(16-11(18)7-14)13(20)17-9(12(15)19)4-5-21-3/h8-10H,4-7,14H2,1-3H3,(H2,15,19)(H,16,18)(H,17,20)/t9-,10-/m0/s1 |
InChiKey: | InChIKey=RLXSTJVYBMNHEP-UWVGGRQHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.