* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-GLY-PRO-LEU-GLY |
| English Synonyms: | Z-GLY-PRO-LEU-GLY |
| MDL Number.: | MFCD00080250 |
| H bond acceptor: | 11 |
| H bond donor: | 4 |
| Smile: | CC(C)C[C@@H](C(=O)NCC(=O)O)NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)OCc2ccccc2 |
| InChi: | InChI=1S/C23H32N4O7/c1-15(2)11-17(21(31)24-13-20(29)30)26-22(32)18-9-6-10-27(18)19(28)12-25-23(33)34-14-16-7-4-3-5-8-16/h3-5,7-8,15,17-18H,6,9-14H2,1-2H3,(H,24,31)(H,25,33)(H,26,32)(H,29,30)/t17-,18-/m0/s1 |
| InChiKey: | InChIKey=BHYBKKFGHQVXFO-ROUUACIJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.