* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-LYS-SBZL |
| English Synonyms: | Z-LYS-SBZL ; Z-LYS-THIOBENZYL ESTER |
| MDL Number.: | MFCD00080253 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)COC(=O)N[C@@H](CCCCN)C(=O)SCc2ccccc2 |
| InChi: | InChI=1S/C21H26N2O3S/c22-14-8-7-13-19(20(24)27-16-18-11-5-2-6-12-18)23-21(25)26-15-17-9-3-1-4-10-17/h1-6,9-12,19H,7-8,13-16,22H2,(H,23,25)/t19-/m0/s1 |
| InChiKey: | InChIKey=FIWAQJRIROPAEC-IBGZPJMESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.