* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-PHE-TYR-LEU |
| English Synonyms: | Z-PHE-TYR-LEU |
| MDL Number.: | MFCD00080254 |
| H bond acceptor: | 10 |
| H bond donor: | 5 |
| Smile: | CC(C)C[C@@H](C(=O)O)NC(=O)[C@H](Cc1ccc(cc1)O)NC(=O)[C@H](Cc2ccccc2)NC(=O)OCc3ccccc3 |
| InChi: | InChI=1S/C32H37N3O7/c1-21(2)17-28(31(39)40)34-29(37)26(19-23-13-15-25(36)16-14-23)33-30(38)27(18-22-9-5-3-6-10-22)35-32(41)42-20-24-11-7-4-8-12-24/h3-16,21,26-28,36H,17-20H2,1-2H3,(H,33,38)(H,34,37)(H,35,41)(H,39,40)/t26-,27-,28-/m0/s1 |
| InChiKey: | InChIKey=KVQKGEMBRHVAOO-KCHLEUMXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.