* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-ALA-TYR-ALA-OH |
CAS: | 81075-03-8 |
English Synonyms: | L-ALA-TYR-ALA ; H-ALA-TYR-ALA-OH |
MDL Number.: | MFCD00080987 |
H bond acceptor: | 8 |
H bond donor: | 5 |
Smile: | C[C@@H](C(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)N[C@@H](C)C(=O)O)N |
InChi: | InChI=1S/C15H21N3O5/c1-8(16)13(20)18-12(14(21)17-9(2)15(22)23)7-10-3-5-11(19)6-4-10/h3-6,8-9,12,19H,7,16H2,1-2H3,(H,17,21)(H,18,20)(H,22,23)/t8-,9-,12-/m0/s1 |
InChiKey: | InChIKey=AENHOIXXHKNIQL-AUTRQRHGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.