* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ESCHOLZINE |
CAS: | 4040-75-9 |
English Synonyms: | ESCHOLZINE |
MDL Number.: | MFCD00082517 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CN1[C@H]2Cc3cc4c(cc3[C@@H]1Cc5c2cc6c(c5)OCO6)OCO4 |
InChi: | InChI=1S/C19H17NO4/c1-20-14-2-10-4-16-18(23-8-21-16)6-12(10)15(20)3-11-5-17-19(7-13(11)14)24-9-22-17/h4-7,14-15H,2-3,8-9H2,1H3/t14-,15-/m0/s1 |
InChiKey: | InChIKey=PGINMPJZCWDQNT-GJZGRUSLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.