* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | L-CYSTEINE HYDANTOIN |
| CAS: | 17125-13-2 |
| English Synonyms: | L-CYSTEINE HYDANTOIN |
| MDL Number.: | MFCD00082886 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | C([C@H]1C(=O)NC(=O)N1)S |
| InChi: | InChI=1S/C4H6N2O2S/c7-3-2(1-9)5-4(8)6-3/h2,9H,1H2,(H2,5,6,7,8)/t2-/m0/s1 |
| InChiKey: | InChIKey=OTZNOKBPJBCNJO-REOHCLBHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.