* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9(R)-HETE |
| CAS: | 107656-14-4 |
| English Synonyms: | 9R-HYDROXY-5Z,7E,11Z,14Z-EICOSATETRAENOIC ACID ; 9(R)-HETE |
| MDL Number.: | MFCD00083381 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | CCCCC/C=C\C/C=C\C[C@H](/C=C/C=C\CCCC(=O)O)O |
| InChi: | InChI=1S/C20H32O3/c1-2-3-4-5-6-7-8-10-13-16-19(21)17-14-11-9-12-15-18-20(22)23/h6-7,9-11,13-14,17,19,21H,2-5,8,12,15-16,18H2,1H3,(H,22,23)/b7-6-,11-9-,13-10-,17-14+/t19-/m1/s1 |
| InChiKey: | InChIKey=KATOYYZUTNAWSA-AZFZJQGOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.