Molecular Structure:
CCD No.:CCD00052296
L-LYSINE,[4,5-3H]
CAS No.:
108158-27-6
;20166-34-1
Formula:C6 H10 N2 O2 T4
MolWeight:154.221
![L-LYSINE,[4,5-3H] Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(9)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | L-LYSINE,[4,5-3H] |
| CAS： | 108158-27-6 ;20166-34-1 |
| English Synonyms： | L-LYSINE, [4,5-3H(N)]- ; LYSINE L [4,5-3H(N)] ; L-LYSINE,[4,5-3H] |
| MDL Number.： | MFCD00083397 |
| H bond acceptor： | 4 |
| H bond donor： | 3 |
| Smile： | [3H]C([3H])(C[C@@H](C(=O)O)N)C([3H])([3H])CN |
| InChiKey： | InChIKey=null |
|
|
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
