* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-GLY-MET-GLY-OH |
CAS: | 51529-34-1 |
English Synonyms: | H-GLY-MET-GLY-OH |
MDL Number.: | MFCD00083705 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | CSCC[C@@H](C(=O)NCC(=O)O)NC(=O)CN |
InChi: | InChI=1S/C9H17N3O4S/c1-17-3-2-6(12-7(13)4-10)9(16)11-5-8(14)15/h6H,2-5,10H2,1H3,(H,11,16)(H,12,13)(H,14,15)/t6-/m0/s1 |
InChiKey: | InChIKey=HHRODZSXDXMUHS-LURJTMIESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.