* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-LEU-LEU-VAL-TYR-OH |
English Synonyms: | H-LEU-LEU-VAL-TYR-OH |
MDL Number.: | MFCD00083758 |
H bond acceptor: | 10 |
H bond donor: | 6 |
Smile: | CC(C)C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)O)N |
InChi: | InChI=1S/C26H42N4O6/c1-14(2)11-19(27)23(32)28-20(12-15(3)4)24(33)30-22(16(5)6)25(34)29-21(26(35)36)13-17-7-9-18(31)10-8-17/h7-10,14-16,19-22,31H,11-13,27H2,1-6H3,(H,28,32)(H,29,34)(H,30,33)(H,35,36)/t19-,20-,21-,22-/m0/s1 |
InChiKey: | InChIKey=UBBRXQXPXQRQDT-CMOCDZPBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.