* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-LYS-TYR-OH |
CAS: | 35978-98-4 |
English Synonyms: | H-LYS-TYR-OH |
MDL Number.: | MFCD00083770 |
H bond acceptor: | 7 |
H bond donor: | 5 |
Smile: | c1cc(ccc1C[C@@H](C(=O)O)NC(=O)[C@H](CCCCN)N)O |
InChi: | InChI=1S/C15H23N3O4/c16-8-2-1-3-12(17)14(20)18-13(15(21)22)9-10-4-6-11(19)7-5-10/h4-7,12-13,19H,1-3,8-9,16-17H2,(H,18,20)(H,21,22)/t12-,13-/m0/s1 |
InChiKey: | InChIKey=MYTOTTSMVMWVJN-STQMWFEESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.