* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-PRO-ALA-GLY-PRO-4M-BETANA |
| CAS: | 100900-21-8 |
| English Synonyms: | Z-PRO-ALA-GLY-PRO-4M-BETANA |
| MDL Number.: | MFCD00083820 |
| H bond acceptor: | 12 |
| H bond donor: | 3 |
| Smile: | C[C@@H](C(=O)NCC(=O)N1CCC[C@H]1C(=O)Nc2cc3ccccc3c(c2)OC)NC(=O)[C@@H]4CCCN4C(=O)OCc5ccccc5 |
| InChi: | InChI=1S/C34H39N5O7/c1-22(36-32(42)28-15-9-17-39(28)34(44)46-21-23-10-4-3-5-11-23)31(41)35-20-30(40)38-16-8-14-27(38)33(43)37-25-18-24-12-6-7-13-26(24)29(19-25)45-2/h3-7,10-13,18-19,22,27-28H,8-9,14-17,20-21H2,1-2H3,(H,35,41)(H,36,42)(H,37,43)/t22-,27-,28-/m0/s1 |
| InChiKey: | InChIKey=VIKZFDLJVQIARV-FAQZDJIUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.