* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | L-MONAPTERIN |
CAS: | 670-65-5 |
English Synonyms: | NEOPTERIN ; L-MONAPTERIN |
MDL Number.: | MFCD00085369 |
H bond acceptor: | 9 |
H bond donor: | 5 |
Smile: | c1c(nc2c(=O)[nH]c(nc2n1)N)[C@@H]([C@H](CO)O)O |
InChi: | InChI=1S/C9H11N5O4/c10-9-13-7-5(8(18)14-9)12-3(1-11-7)6(17)4(16)2-15/h1,4,6,15-17H,2H2,(H3,10,11,13,14,18)/t4-,6-/m0/s1 |
InChiKey: | InChIKey=BMQYVXCPAOLZOK-NJGYIYPDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.