* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-BROMOISATIN 3-OXIME |
CAS: | 49875-78-7 |
English Synonyms: | 5-BROMOISATIN 3-OXIME |
MDL Number.: | MFCD00091876 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1cc2c(cc1Br)/C(=N\O)/C(=O)N2 |
InChi: | InChI=1S/C8H5BrN2O2/c9-4-1-2-6-5(3-4)7(11-13)8(12)10-6/h1-3,13H,(H,10,11,12) |
InChiKey: | InChIKey=APYQTLASEQODSC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.