* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1047161 |
English Synonyms: | OTAVA-BB 1047161 |
MDL Number.: | MFCD00092129 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | Cc1ccc(cc1)S(=O)(=O)C(C)(C)CC(=O)C |
InChi: | InChI=1S/C13H18O3S/c1-10-5-7-12(8-6-10)17(15,16)13(3,4)9-11(2)14/h5-8H,9H2,1-4H3 |
InChiKey: | InChIKey=VPQHNQXZPFLQMI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.