* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BP 0988 |
English Synonyms: | RARECHEM AL BP 0988 |
MDL Number.: | MFCD00098350 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | Cc1c(c(on1)/C=C/c2c(ccs2)C3OCCO3)[N+](=O)[O-] |
InChi: | InChI=1S/C13H12N2O5S/c1-8-12(15(16)17)10(20-14-8)2-3-11-9(4-7-21-11)13-18-5-6-19-13/h2-4,7,13H,5-6H2,1H3/b3-2+ |
InChiKey: | InChIKey=HTELMMSRYFDRJF-NSCUHMNNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.