* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1,2,4-TRIAZOLO[3,4-B]BENZOTHIAZOLE |
| CAS: | 247-92-7 |
| English Synonyms: | 1,2,4-TRIAZOLO[3,4-B]BENZOTHIAZOLE ; BUTTPARK 61\40-40 ; (1,2,4)TRIAZOLO(3,4-B)(1,3)BENZOTHIAZOLE |
| MDL Number.: | MFCD00099327 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1ccc2c(c1)n3cnnc3s2 |
| InChi: | InChI=1S/C8H5N3S/c1-2-4-7-6(3-1)11-5-9-10-8(11)12-7/h1-5H |
| InChiKey: | InChIKey=BGFURDBGMRKOTL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.