* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZX-IP007012 |
| English Synonyms: | ZERENEX ZX-IP007012 |
| MDL Number.: | MFCD00099430 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | C=CCn1c(n[nH]c1=S)c2ccccc2O |
| InChi: | InChI=1S/C11H11N3OS/c1-2-7-14-10(12-13-11(14)16)8-5-3-4-6-9(8)15/h2-6,15H,1,7H2,(H,13,16) |
| InChiKey: | InChIKey=KZAQFAGWXZOUIA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.