* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | G-32465 |
CAS: | 38942-51-7 |
English Synonyms: | G-32465 |
MDL Number.: | MFCD00099442 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cn1c(n[nH]c1=S)c2ccccc2 |
InChi: | InChI=1S/C9H9N3S/c1-12-8(10-11-9(12)13)7-5-3-2-4-6-7/h2-6H,1H3,(H,11,13) |
InChiKey: | InChIKey=XGLHJEZLNGXEAZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.