* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1312942 |
English Synonyms: | OTAVA-BB 1312942 |
MDL Number.: | MFCD00101548 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | Cc1cc(c(c(c1)C)C(=O)CCCCl)C |
InChi: | InChI=1S/C13H17ClO/c1-9-7-10(2)13(11(3)8-9)12(15)5-4-6-14/h7-8H,4-6H2,1-3H3 |
InChiKey: | InChIKey=IGTJGHVNRJRHFE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.