* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BO 1684 |
English Synonyms: | RARECHEM AL BO 1684 |
MDL Number.: | MFCD00102453 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)COc2ccccc2C(=O)/C=C/c3ccc(cc3)C(=O)O |
InChi: | InChI=1S/C23H18O4/c24-21(15-12-17-10-13-19(14-11-17)23(25)26)20-8-4-5-9-22(20)27-16-18-6-2-1-3-7-18/h1-15H,16H2,(H,25,26)/b15-12+ |
InChiKey: | InChIKey=ADMBFEMBJMDZNV-NTCAYCPXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.