* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL FF 0052 |
English Synonyms: | RARECHEM AL FF 0052 |
MDL Number.: | MFCD00102771 |
H bond acceptor: | 9 |
H bond donor: | 1 |
Smile: | Cc1ccc(cc1)n2c(nnn2)C/C=N/Nc3ccc(cc3)[N+](=O)[O-] |
InChi: | InChI=1S/C16H15N7O2/c1-12-2-6-14(7-3-12)22-16(19-20-21-22)10-11-17-18-13-4-8-15(9-5-13)23(24)25/h2-9,11,18H,10H2,1H3/b17-11+ |
InChiKey: | InChIKey=YJNMTOGIZHNIEA-GZTJUZNOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.