* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL FF 0054 |
English Synonyms: | RARECHEM AL FF 0054 |
MDL Number.: | MFCD00102775 |
H bond acceptor: | 9 |
H bond donor: | 1 |
Smile: | c1cc(ccc1N/N=C/Cc2nnnn2c3ccc(cc3)Cl)[N+](=O)[O-] |
InChi: | InChI=1S/C15H12ClN7O2/c16-11-1-5-13(6-2-11)22-15(19-20-21-22)9-10-17-18-12-3-7-14(8-4-12)23(24)25/h1-8,10,18H,9H2/b17-10+ |
InChiKey: | InChIKey=GNZQWFAQQHTSAN-LICLKQGHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.