* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL F1 4008 |
English Synonyms: | RARECHEM AL F1 4008 |
MDL Number.: | MFCD00102807 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CCc1ccc(cc1)n2c(nnn2)/C=C/N(C)C |
InChi: | InChI=1S/C13H17N5/c1-4-11-5-7-12(8-6-11)18-13(14-15-16-18)9-10-17(2)3/h5-10H,4H2,1-3H3/b10-9+ |
InChiKey: | InChIKey=MASSPSCLXNBFAD-MDZDMXLPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.