* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL FB 0006 |
English Synonyms: | RARECHEM AL FB 0006 |
MDL Number.: | MFCD00102809 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | c1cc(ccc1n2c(nnn2)/C=C/N3CCCC3)F |
InChi: | InChI=1S/C13H14FN5/c14-11-3-5-12(6-4-11)19-13(15-16-17-19)7-10-18-8-1-2-9-18/h3-7,10H,1-2,8-9H2/b10-7+ |
InChiKey: | InChIKey=GFKSQWBBYCCYCT-JXMROGBWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.