* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL FL 0078 |
English Synonyms: | RARECHEM AL FL 0078 |
MDL Number.: | MFCD00102830 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cc1ccc(cc1)N/C=C\c2nnnn2c3ccccc3 |
InChi: | InChI=1S/C16H15N5/c1-13-7-9-14(10-8-13)17-12-11-16-18-19-20-21(16)15-5-3-2-4-6-15/h2-12,17H,1H3/b12-11- |
InChiKey: | InChIKey=GGJIMJISQJCYFP-QXMHVHEDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.