* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL FD 0054 |
English Synonyms: | RARECHEM AL FD 0054 |
MDL Number.: | MFCD00102836 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)n2c(nnn2)/C=C\Nc3ccc(cc3)O |
InChi: | InChI=1S/C15H13N5O/c21-14-8-6-12(7-9-14)16-11-10-15-17-18-19-20(15)13-4-2-1-3-5-13/h1-11,16,21H/b11-10- |
InChiKey: | InChIKey=FOZHWKDHBKQUHC-KHPPLWFESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.