* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL FC 0006 |
English Synonyms: | RARECHEM AL FC 0006 |
MDL Number.: | MFCD00102856 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)/C(=C/C(=C/2\C(=O)N=C(S2)N3CCCC3)/c4ccccc4)/CC(=O)c5ccccc5 |
InChi: | InChI=1S/C30H26N2O2S/c33-27(24-16-8-3-9-17-24)21-25(22-12-4-1-5-13-22)20-26(23-14-6-2-7-15-23)28-29(34)31-30(35-28)32-18-10-11-19-32/h1-9,12-17,20H,10-11,18-19,21H2/b25-20+,28-26- |
InChiKey: | InChIKey=DOLSGHRNPZEHEC-JKWYUJKRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.