* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL FC 0019 |
English Synonyms: | RARECHEM AL FC 0019 |
MDL Number.: | MFCD00102904 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | Cc1ccc(cc1)n2c(nnn2)/C=C/N3CCCC3 |
InChi: | InChI=1S/C14H17N5/c1-12-4-6-13(7-5-12)19-14(15-16-17-19)8-11-18-9-2-3-10-18/h4-8,11H,2-3,9-10H2,1H3/b11-8+ |
InChiKey: | InChIKey=GFXVKCCBZVADJN-DHZHZOJOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.