Molecular Structure:
CCD No.:CCD00057326
OTAVA-BB 1358611
Formula:C17 H17 N O4
MolWeight:299.324
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1358611 |
| English Synonyms： | OTAVA-BB 1358611 |
| MDL Number.： | MFCD00105402 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | CC(=O)c1ccccc1NC(=O)C2C3CC(C2C(=O)O)C=C3 |
| InChi： | InChI=1S/C17H17NO4/c1-9(19)12-4-2-3-5-13(12)18-16(20)14-10-6-7-11(8-10)15(14)17(21)22/h2-7,10-11,14-15H,8H2,1H3,(H,18,20)(H,21,22) |
| InChiKey： | InChIKey=SQSDJAWERKOUOS-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
