* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1317241 |
English Synonyms: | OTAVA-BB 1317241 |
MDL Number.: | MFCD00107716 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | COc1cc(ccc1O)/C=C\2/C(=O)NC(=O)N2 |
InChi: | InChI=1S/C11H10N2O4/c1-17-9-5-6(2-3-8(9)14)4-7-10(15)13-11(16)12-7/h2-5,14H,1H3,(H2,12,13,15,16)/b7-4- |
InChiKey: | InChIKey=JLQMLBNABLDJJM-DAXSKMNVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.