* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BP 1156 |
| English Synonyms: | RARECHEM AL BP 1156 |
| MDL Number.: | MFCD00112684 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | CC(C)(C)S(=O)(=O)/C(=C/c1c(ccs1)C2OCCO2)/C#N |
| InChi: | InChI=1S/C14H17NO4S2/c1-14(2,3)21(16,17)10(9-15)8-12-11(4-7-20-12)13-18-5-6-19-13/h4,7-8,13H,5-6H2,1-3H3/b10-8+ |
| InChiKey: | InChIKey=KKJYAGFAXWHDOK-CSKARUKUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.