* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1321567 |
English Synonyms: | OTAVA-BB 1321567 |
MDL Number.: | MFCD00114342 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | c1ccc2c(c1)c(c[nH]2)CCNC(=O)CCCC(=O)O |
InChi: | InChI=1S/C15H18N2O3/c18-14(6-3-7-15(19)20)16-9-8-11-10-17-13-5-2-1-4-12(11)13/h1-2,4-5,10,17H,3,6-9H2,(H,16,18)(H,19,20) |
InChiKey: | InChIKey=ADNUGOGDMFDOTO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.