* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-PENTYL-9H-FLUOREN-2-OL |
CAS: | 99012-40-5 |
English Synonyms: | 7-PENTYL-9H-FLUOREN-2-OL |
MDL Number.: | MFCD00114640 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCCCCc1ccc-2c(c1)Cc3c2ccc(c3)O |
InChi: | InChI=1S/C18H20O/c1-2-3-4-5-13-6-8-17-14(10-13)11-15-12-16(19)7-9-18(15)17/h6-10,12,19H,2-5,11H2,1H3 |
InChiKey: | InChIKey=KVLMFEDZEZXVBC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.