* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL FD 0089 |
English Synonyms: | RARECHEM AL FD 0089 |
MDL Number.: | MFCD00114724 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)/C(=C/C(=C/2\C(=O)NC(=S)S2)/c3ccc(cc3)Cl)/CC(=O)c4ccc(cc4)Cl |
InChi: | InChI=1S/C26H17Cl2NO2S2/c27-20-10-6-17(7-11-20)22(24-25(31)29-26(32)33-24)14-19(16-4-2-1-3-5-16)15-23(30)18-8-12-21(28)13-9-18/h1-14H,15H2,(H,29,31,32)/b19-14+,24-22- |
InChiKey: | InChIKey=ZJVSHWMHMPTXEL-GDBHHJMHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.