* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL FI 0033 |
| English Synonyms: | RARECHEM AL FI 0033 |
| MDL Number.: | MFCD00114754 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | COc1ccc(cc1)N/C=C\c2nnnn2c3ccc(cc3)Br |
| InChi: | InChI=1S/C16H14BrN5O/c1-23-15-8-4-13(5-9-15)18-11-10-16-19-20-21-22(16)14-6-2-12(17)3-7-14/h2-11,18H,1H3/b11-10- |
| InChiKey: | InChIKey=FIROPRPTDLRILV-KHPPLWFESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.