* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL FF 0038 |
English Synonyms: | RARECHEM AL FF 0038 |
MDL Number.: | MFCD00114755 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | COc1ccc(cc1)N/C=C\c2nnnn2c3ccc(cc3)OC |
InChi: | InChI=1S/C17H17N5O2/c1-23-15-7-3-13(4-8-15)18-12-11-17-19-20-21-22(17)14-5-9-16(24-2)10-6-14/h3-12,18H,1-2H3/b12-11- |
InChiKey: | InChIKey=WDFORTCLLORSJQ-QXMHVHEDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.