* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL F1 4026 |
English Synonyms: | RARECHEM AL F1 4026 |
MDL Number.: | MFCD00114764 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cc(ccc1N/C=C\c2nnnn2c3ccc(cc3)F)Br |
InChi: | InChI=1S/C15H11BrFN5/c16-11-1-5-13(6-2-11)18-10-9-15-19-20-21-22(15)14-7-3-12(17)4-8-14/h1-10,18H/b10-9- |
InChiKey: | InChIKey=FJFBATRFEXOESD-KTKRTIGZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.